3-bromo-N-[2-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)thiophen-3-yl]benzamide
Chemical Structure Depiction of
3-bromo-N-[2-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)thiophen-3-yl]benzamide
3-bromo-N-[2-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)thiophen-3-yl]benzamide
Compound characteristics
| Compound ID: | P180-0544 |
| Compound Name: | 3-bromo-N-[2-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)thiophen-3-yl]benzamide |
| Molecular Weight: | 390.26 |
| Molecular Formula: | C16 H12 Br N3 O2 S |
| Smiles: | C1CC1c1nnc(c2c(ccs2)NC(c2cccc(c2)[Br])=O)o1 |
| Stereo: | ACHIRAL |
| logP: | 4.1532 |
| logD: | 4.1532 |
| logSw: | -4.3298 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.417 |
| InChI Key: | USYSBWHUTUGEMP-UHFFFAOYSA-N |