N-{2-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]thiophen-3-yl}-6-methoxypyridine-3-carboxamide
Chemical Structure Depiction of
N-{2-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]thiophen-3-yl}-6-methoxypyridine-3-carboxamide
N-{2-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]thiophen-3-yl}-6-methoxypyridine-3-carboxamide
Compound characteristics
| Compound ID: | P181-0737 |
| Compound Name: | N-{2-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]thiophen-3-yl}-6-methoxypyridine-3-carboxamide |
| Molecular Weight: | 396.4 |
| Molecular Formula: | C19 H13 F N4 O3 S |
| Smiles: | COc1ccc(cn1)C(Nc1ccsc1c1nc(c2ccc(cc2)F)no1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.4156 |
| logD: | 4.4156 |
| logSw: | -4.2807 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 71.638 |
| InChI Key: | XCXCWSSOKPTZRW-UHFFFAOYSA-N |