3-fluoro-N-{2-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]thiophen-3-yl}benzamide
Chemical Structure Depiction of
3-fluoro-N-{2-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]thiophen-3-yl}benzamide
3-fluoro-N-{2-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]thiophen-3-yl}benzamide
Compound characteristics
| Compound ID: | P181-0763 |
| Compound Name: | 3-fluoro-N-{2-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]thiophen-3-yl}benzamide |
| Molecular Weight: | 383.37 |
| Molecular Formula: | C19 H11 F2 N3 O2 S |
| Smiles: | c1cc(cc(c1)F)C(Nc1ccsc1c1nc(c2ccc(cc2)F)no1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.9705 |
| logD: | 4.9704 |
| logSw: | -5.0574 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.056 |
| InChI Key: | XHHNBXYUWOIKJF-UHFFFAOYSA-N |