1-ethyl-N-{2-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]thiophen-3-yl}-1H-pyrazole-3-carboxamide
Chemical Structure Depiction of
1-ethyl-N-{2-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]thiophen-3-yl}-1H-pyrazole-3-carboxamide
1-ethyl-N-{2-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]thiophen-3-yl}-1H-pyrazole-3-carboxamide
Compound characteristics
| Compound ID: | P181-1085 |
| Compound Name: | 1-ethyl-N-{2-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]thiophen-3-yl}-1H-pyrazole-3-carboxamide |
| Molecular Weight: | 379.44 |
| Molecular Formula: | C19 H17 N5 O2 S |
| Smiles: | CCn1ccc(C(Nc2ccsc2c2nc(c3cccc(C)c3)no2)=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 3.9441 |
| logD: | 3.9441 |
| logSw: | -3.8834 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 69.441 |
| InChI Key: | VGEVTLLIDJMVPC-UHFFFAOYSA-N |