N-[(1-methyl-1H-indazol-3-yl)methyl]thiophene-3-carboxamide
Chemical Structure Depiction of
N-[(1-methyl-1H-indazol-3-yl)methyl]thiophene-3-carboxamide
N-[(1-methyl-1H-indazol-3-yl)methyl]thiophene-3-carboxamide
Compound characteristics
| Compound ID: | P184-0325 |
| Compound Name: | N-[(1-methyl-1H-indazol-3-yl)methyl]thiophene-3-carboxamide |
| Molecular Weight: | 271.34 |
| Molecular Formula: | C14 H13 N3 O S |
| Smiles: | Cn1c2ccccc2c(CNC(c2ccsc2)=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 2.1246 |
| logD: | 2.1246 |
| logSw: | -2.6435 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.701 |
| InChI Key: | LQPXRCQXZRCXQY-UHFFFAOYSA-N |