2-[4,5-dimethyl-6-oxo-2-(piperidin-1-yl)pyrimidin-1(6H)-yl]-N-(4-ethylphenyl)acetamide
Chemical Structure Depiction of
2-[4,5-dimethyl-6-oxo-2-(piperidin-1-yl)pyrimidin-1(6H)-yl]-N-(4-ethylphenyl)acetamide
2-[4,5-dimethyl-6-oxo-2-(piperidin-1-yl)pyrimidin-1(6H)-yl]-N-(4-ethylphenyl)acetamide
Compound characteristics
| Compound ID: | P194-1803 |
| Compound Name: | 2-[4,5-dimethyl-6-oxo-2-(piperidin-1-yl)pyrimidin-1(6H)-yl]-N-(4-ethylphenyl)acetamide |
| Molecular Weight: | 368.48 |
| Molecular Formula: | C21 H28 N4 O2 |
| Smiles: | CCc1ccc(cc1)NC(CN1C(=NC(C)=C(C)C1=O)N1CCCCC1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.3834 |
| logD: | 3.3834 |
| logSw: | -3.4444 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 51.623 |
| InChI Key: | XQIBRFGBTWMPLS-UHFFFAOYSA-N |