rel-(1R,2S,4R)-4-(5-{[(tert-butoxycarbonyl)amino]methyl}-1,3,4-oxadiazol-2-yl)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)cyclopentane-1-carboxylic acid
Chemical Structure Depiction of
rel-(1R,2S,4R)-4-(5-{[(tert-butoxycarbonyl)amino]methyl}-1,3,4-oxadiazol-2-yl)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)cyclopentane-1-carboxylic acid
rel-(1R,2S,4R)-4-(5-{[(tert-butoxycarbonyl)amino]methyl}-1,3,4-oxadiazol-2-yl)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)cyclopentane-1-carboxylic acid
Compound characteristics
| Compound ID: | P207-9104 |
| Compound Name: | rel-(1R,2S,4R)-4-(5-{[(tert-butoxycarbonyl)amino]methyl}-1,3,4-oxadiazol-2-yl)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)cyclopentane-1-carboxylic acid |
| Molecular Weight: | 548.6 |
| Molecular Formula: | C29 H32 N4 O7 |
| Smiles: | CC(C)(C)OC(NCc1nnc([C@H]2C[C@@H]([C@@H](C2)C(O)=O)NC(=O)OCC2c3ccccc3c3ccccc23)o1)=O |
| Stereo: | RACEMIC MIXTURE (RELATIVE) |
| logP: | 4.1825 |
| logD: | 1.8395 |
| logSw: | -4.2614 |
| Hydrogen bond acceptors count: | 12 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 124.07 |
| InChI Key: | OLXLUZBBIBEPFZ-YTJPUZGESA-N |