2-chloro-N-[2-(4-methylphenyl)pyrimidin-5-yl]-5-(methylsulfanyl)benzamide
Chemical Structure Depiction of
2-chloro-N-[2-(4-methylphenyl)pyrimidin-5-yl]-5-(methylsulfanyl)benzamide
2-chloro-N-[2-(4-methylphenyl)pyrimidin-5-yl]-5-(methylsulfanyl)benzamide
Compound characteristics
| Compound ID: | P212-0736 |
| Compound Name: | 2-chloro-N-[2-(4-methylphenyl)pyrimidin-5-yl]-5-(methylsulfanyl)benzamide |
| Molecular Weight: | 369.87 |
| Molecular Formula: | C19 H16 Cl N3 O S |
| Smiles: | Cc1ccc(cc1)c1ncc(cn1)NC(c1cc(ccc1[Cl])SC)=O |
| Stereo: | ACHIRAL |
| logP: | 5.144 |
| logD: | 5.1434 |
| logSw: | -5.4686 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 42.673 |
| InChI Key: | MIGACCQQZJLETJ-UHFFFAOYSA-N |