2-[4-(trifluoromethyl)phenyl]pyrimidin-5-amine
Chemical Structure Depiction of
2-[4-(trifluoromethyl)phenyl]pyrimidin-5-amine
2-[4-(trifluoromethyl)phenyl]pyrimidin-5-amine
Compound characteristics
| Compound ID: | P212-1980 |
| Compound Name: | 2-[4-(trifluoromethyl)phenyl]pyrimidin-5-amine |
| Molecular Weight: | 239.2 |
| Molecular Formula: | C11 H8 F3 N3 |
| Smiles: | c1cc(ccc1c1ncc(cn1)N)C(F)(F)F |
| Stereo: | ACHIRAL |
| logP: | 2.5274 |
| logD: | 2.527 |
| logSw: | -2.2994 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 40.387 |
| InChI Key: | VHJVKEFNWVQJNW-UHFFFAOYSA-N |