6-chloro-N-(2,5-dimethoxyphenyl)imidazo[1,2-b]pyridazine-2-carboxamide
Chemical Structure Depiction of
6-chloro-N-(2,5-dimethoxyphenyl)imidazo[1,2-b]pyridazine-2-carboxamide
6-chloro-N-(2,5-dimethoxyphenyl)imidazo[1,2-b]pyridazine-2-carboxamide
Compound characteristics
| Compound ID: | P307-0747 |
| Compound Name: | 6-chloro-N-(2,5-dimethoxyphenyl)imidazo[1,2-b]pyridazine-2-carboxamide |
| Molecular Weight: | 332.74 |
| Molecular Formula: | C15 H13 Cl N4 O3 |
| Smiles: | COc1ccc(c(c1)NC(c1cn2c(ccc(n2)[Cl])n1)=O)OC |
| Stereo: | ACHIRAL |
| logP: | 2.1366 |
| logD: | 2.1271 |
| logSw: | -3.1761 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.368 |
| InChI Key: | DRBRXZPLGIURFA-UHFFFAOYSA-N |