N-[1-(3,5-dimethylphenyl)-2-oxopyrrolidin-3-yl]-N'-phenylurea
Chemical Structure Depiction of
N-[1-(3,5-dimethylphenyl)-2-oxopyrrolidin-3-yl]-N'-phenylurea
N-[1-(3,5-dimethylphenyl)-2-oxopyrrolidin-3-yl]-N'-phenylurea
Compound characteristics
| Compound ID: | P315-0717 |
| Compound Name: | N-[1-(3,5-dimethylphenyl)-2-oxopyrrolidin-3-yl]-N'-phenylurea |
| Molecular Weight: | 323.39 |
| Molecular Formula: | C19 H21 N3 O2 |
| Smiles: | Cc1cc(C)cc(c1)N1CCC(C1=O)NC(Nc1ccccc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.2416 |
| logD: | 3.2416 |
| logSw: | -3.4755 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 50.326 |
| InChI Key: | LHYNDSCSTQLXHN-KRWDZBQOSA-N |