2,5-dimethoxy-N-(2-oxo-1-phenylpyrrolidin-3-yl)benzene-1-sulfonamide
Chemical Structure Depiction of
2,5-dimethoxy-N-(2-oxo-1-phenylpyrrolidin-3-yl)benzene-1-sulfonamide
2,5-dimethoxy-N-(2-oxo-1-phenylpyrrolidin-3-yl)benzene-1-sulfonamide
Compound characteristics
| Compound ID: | P316-0024 |
| Compound Name: | 2,5-dimethoxy-N-(2-oxo-1-phenylpyrrolidin-3-yl)benzene-1-sulfonamide |
| Molecular Weight: | 376.43 |
| Molecular Formula: | C18 H20 N2 O5 S |
| Smiles: | COc1ccc(c(c1)S(NC1CCN(C1=O)c1ccccc1)(=O)=O)OC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.0958 |
| logD: | 2.0956 |
| logSw: | -2.9501 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 73.846 |
| InChI Key: | RFWPGYTZGKYNJA-HNNXBMFYSA-N |