{1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]piperidin-4-yl}[4-(4-methylphenyl)piperazin-1-yl]methanone
Chemical Structure Depiction of
{1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]piperidin-4-yl}[4-(4-methylphenyl)piperazin-1-yl]methanone
{1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]piperidin-4-yl}[4-(4-methylphenyl)piperazin-1-yl]methanone
Compound characteristics
| Compound ID: | P321-0353 |
| Compound Name: | {1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]piperidin-4-yl}[4-(4-methylphenyl)piperazin-1-yl]methanone |
| Molecular Weight: | 445.56 |
| Molecular Formula: | C26 H31 N5 O2 |
| Smiles: | Cc1ccc(cc1)c1nnc(N2CCC(CC2)C(N2CCN(CC2)c2ccc(C)cc2)=O)o1 |
| Stereo: | ACHIRAL |
| logP: | 4.2003 |
| logD: | 4.1999 |
| logSw: | -4.1149 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 54.187 |
| InChI Key: | QPUMJHIURFSWQK-UHFFFAOYSA-N |