5-[(4-fluorophenyl)methyl]-2-methyl-N-[(2-methylphenyl)methyl]-4-oxo-4,5-dihydrofuro[3,2-c]pyridine-3-carboxamide
Chemical Structure Depiction of
5-[(4-fluorophenyl)methyl]-2-methyl-N-[(2-methylphenyl)methyl]-4-oxo-4,5-dihydrofuro[3,2-c]pyridine-3-carboxamide
5-[(4-fluorophenyl)methyl]-2-methyl-N-[(2-methylphenyl)methyl]-4-oxo-4,5-dihydrofuro[3,2-c]pyridine-3-carboxamide
Compound characteristics
| Compound ID: | P328-1676 |
| Compound Name: | 5-[(4-fluorophenyl)methyl]-2-methyl-N-[(2-methylphenyl)methyl]-4-oxo-4,5-dihydrofuro[3,2-c]pyridine-3-carboxamide |
| Molecular Weight: | 404.44 |
| Molecular Formula: | C24 H21 F N2 O3 |
| Smiles: | Cc1ccccc1CNC(c1c2C(N(Cc3ccc(cc3)F)C=Cc2oc1C)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.6725 |
| logD: | 3.6723 |
| logSw: | -3.9648 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.322 |
| InChI Key: | ZFXJTDUMPABJMW-UHFFFAOYSA-N |