(3-{[3-(dimethylamino)pyrazin-2-yl]oxy}pyrrolidin-1-yl)(4-ethylphenyl)methanone
Chemical Structure Depiction of
(3-{[3-(dimethylamino)pyrazin-2-yl]oxy}pyrrolidin-1-yl)(4-ethylphenyl)methanone
(3-{[3-(dimethylamino)pyrazin-2-yl]oxy}pyrrolidin-1-yl)(4-ethylphenyl)methanone
Compound characteristics
| Compound ID: | P396-0016 |
| Compound Name: | (3-{[3-(dimethylamino)pyrazin-2-yl]oxy}pyrrolidin-1-yl)(4-ethylphenyl)methanone |
| Molecular Weight: | 340.42 |
| Molecular Formula: | C19 H24 N4 O2 |
| Smiles: | CCc1ccc(cc1)C(N1CCC(C1)Oc1c(nccn1)N(C)C)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.7771 |
| logD: | 2.777 |
| logSw: | -2.7281 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 45.039 |
| InChI Key: | IMOBZBWPDPYFBF-MRXNPFEDSA-N |