1-{4-[5-methyl-4-(morpholine-4-carbonyl)-1,3-oxazol-2-yl]piperidin-1-yl}-4-phenylbutan-1-one
					Chemical Structure Depiction of
1-{4-[5-methyl-4-(morpholine-4-carbonyl)-1,3-oxazol-2-yl]piperidin-1-yl}-4-phenylbutan-1-one
			1-{4-[5-methyl-4-(morpholine-4-carbonyl)-1,3-oxazol-2-yl]piperidin-1-yl}-4-phenylbutan-1-one
Compound characteristics
| Compound ID: | P435-0556 | 
| Compound Name: | 1-{4-[5-methyl-4-(morpholine-4-carbonyl)-1,3-oxazol-2-yl]piperidin-1-yl}-4-phenylbutan-1-one | 
| Molecular Weight: | 425.53 | 
| Molecular Formula: | C24 H31 N3 O4 | 
| Smiles: | Cc1c(C(N2CCOCC2)=O)nc(C2CCN(CC2)C(CCCc2ccccc2)=O)o1 | 
| Stereo: | ACHIRAL | 
| logP: | 2.811 | 
| logD: | 2.811 | 
| logSw: | -3.0073 | 
| Hydrogen bond acceptors count: | 7 | 
| Polar surface area: | 58.543 | 
| InChI Key: | BKSHYBZQRZPTHR-UHFFFAOYSA-N | 
 
				 
				