2-{3-[(4-chlorophenyl)methyl]-1H-1,2,4-triazol-5-yl}-N-(4-methylphenyl)acetamide
Chemical Structure Depiction of
2-{3-[(4-chlorophenyl)methyl]-1H-1,2,4-triazol-5-yl}-N-(4-methylphenyl)acetamide
2-{3-[(4-chlorophenyl)methyl]-1H-1,2,4-triazol-5-yl}-N-(4-methylphenyl)acetamide
Compound characteristics
| Compound ID: | P496-2213 |
| Compound Name: | 2-{3-[(4-chlorophenyl)methyl]-1H-1,2,4-triazol-5-yl}-N-(4-methylphenyl)acetamide |
| Molecular Weight: | 340.81 |
| Molecular Formula: | C18 H17 Cl N4 O |
| Smiles: | Cc1ccc(cc1)NC(Cc1nc(Cc2ccc(cc2)[Cl])n[nH]1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.9207 |
| logD: | 3.9181 |
| logSw: | -4.2953 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 58.882 |
| InChI Key: | GODWMRKKNYFEBO-UHFFFAOYSA-N |