N-benzyl-2-[2-(3,5-difluoroanilino)-2-oxoethyl]-4-methyl-1,3-thiazole-5-carboxamide
Chemical Structure Depiction of
N-benzyl-2-[2-(3,5-difluoroanilino)-2-oxoethyl]-4-methyl-1,3-thiazole-5-carboxamide
N-benzyl-2-[2-(3,5-difluoroanilino)-2-oxoethyl]-4-methyl-1,3-thiazole-5-carboxamide
Compound characteristics
| Compound ID: | P497-0920 |
| Compound Name: | N-benzyl-2-[2-(3,5-difluoroanilino)-2-oxoethyl]-4-methyl-1,3-thiazole-5-carboxamide |
| Molecular Weight: | 401.43 |
| Molecular Formula: | C20 H17 F2 N3 O2 S |
| Smiles: | Cc1c(C(NCc2ccccc2)=O)sc(CC(Nc2cc(cc(c2)F)F)=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 3.9077 |
| logD: | 3.8986 |
| logSw: | -4.0626 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 58.607 |
| InChI Key: | OUXPJZMZRYPPGT-UHFFFAOYSA-N |