2-[2-(2,4-difluoroanilino)-2-oxoethyl]-N-[(4-fluorophenyl)methyl]-4-methyl-1,3-thiazole-5-carboxamide
Chemical Structure Depiction of
2-[2-(2,4-difluoroanilino)-2-oxoethyl]-N-[(4-fluorophenyl)methyl]-4-methyl-1,3-thiazole-5-carboxamide
2-[2-(2,4-difluoroanilino)-2-oxoethyl]-N-[(4-fluorophenyl)methyl]-4-methyl-1,3-thiazole-5-carboxamide
Compound characteristics
| Compound ID: | P497-1033 |
| Compound Name: | 2-[2-(2,4-difluoroanilino)-2-oxoethyl]-N-[(4-fluorophenyl)methyl]-4-methyl-1,3-thiazole-5-carboxamide |
| Molecular Weight: | 419.42 |
| Molecular Formula: | C20 H16 F3 N3 O2 S |
| Smiles: | Cc1c(C(NCc2ccc(cc2)F)=O)sc(CC(Nc2ccc(cc2F)F)=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 3.3903 |
| logD: | 3.3827 |
| logSw: | -3.8097 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 57.909 |
| InChI Key: | MLHIJXSQJNXOMJ-UHFFFAOYSA-N |