N-(2,3-dimethylphenyl)-2-[4-(3-fluorophenyl)-1,1-dioxo-3,4-dihydro-1lambda~6~-pyrido[2,3-e][1,2,4]thiadiazin-2(1H)-yl]acetamide
Chemical Structure Depiction of
N-(2,3-dimethylphenyl)-2-[4-(3-fluorophenyl)-1,1-dioxo-3,4-dihydro-1lambda~6~-pyrido[2,3-e][1,2,4]thiadiazin-2(1H)-yl]acetamide
N-(2,3-dimethylphenyl)-2-[4-(3-fluorophenyl)-1,1-dioxo-3,4-dihydro-1lambda~6~-pyrido[2,3-e][1,2,4]thiadiazin-2(1H)-yl]acetamide
Compound characteristics
| Compound ID: | P585-2665 |
| Compound Name: | N-(2,3-dimethylphenyl)-2-[4-(3-fluorophenyl)-1,1-dioxo-3,4-dihydro-1lambda~6~-pyrido[2,3-e][1,2,4]thiadiazin-2(1H)-yl]acetamide |
| Molecular Weight: | 440.5 |
| Molecular Formula: | C22 H21 F N4 O3 S |
| Smiles: | Cc1cccc(c1C)NC(CN1CN(c2cccc(c2)F)c2c(cccn2)S1(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.0332 |
| logD: | 4.0332 |
| logSw: | -4.0044 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 67.267 |
| InChI Key: | WXAZXCZPDOTCOQ-UHFFFAOYSA-N |