3-[4-(4-methylphenyl)piperazine-1-sulfonyl]-1-propyl-1H-pyrazole-4-carboxylic acid
Chemical Structure Depiction of
3-[4-(4-methylphenyl)piperazine-1-sulfonyl]-1-propyl-1H-pyrazole-4-carboxylic acid
3-[4-(4-methylphenyl)piperazine-1-sulfonyl]-1-propyl-1H-pyrazole-4-carboxylic acid
Compound characteristics
| Compound ID: | P593-0672 |
| Compound Name: | 3-[4-(4-methylphenyl)piperazine-1-sulfonyl]-1-propyl-1H-pyrazole-4-carboxylic acid |
| Molecular Weight: | 392.48 |
| Molecular Formula: | C18 H24 N4 O4 S |
| Smiles: | CCCn1cc(C(O)=O)c(n1)S(N1CCN(CC1)c1ccc(C)cc1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.6063 |
| logD: | -1.5002 |
| logSw: | -2.8681 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 78.695 |
| InChI Key: | FNQLWLLJYJXMQB-UHFFFAOYSA-N |