N-(3-ethylphenyl)-4-methyl-2-(1-methyl-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,3-thiazole-5-carboxamide
Chemical Structure Depiction of
N-(3-ethylphenyl)-4-methyl-2-(1-methyl-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,3-thiazole-5-carboxamide
N-(3-ethylphenyl)-4-methyl-2-(1-methyl-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,3-thiazole-5-carboxamide
Compound characteristics
| Compound ID: | P611-0230 |
| Compound Name: | N-(3-ethylphenyl)-4-methyl-2-(1-methyl-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,3-thiazole-5-carboxamide |
| Molecular Weight: | 376.48 |
| Molecular Formula: | C21 H20 N4 O S |
| Smiles: | CCc1cccc(c1)NC(c1c(C)nc(c2cn(C)c3c2cccn3)s1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.3222 |
| logD: | 4.3179 |
| logSw: | -4.1893 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.107 |
| InChI Key: | OGYHQUIOJXPVHS-UHFFFAOYSA-N |