N-(3,4-dimethoxyphenyl)-2-methyl-3-oxo-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine-2-carboxamide
Chemical Structure Depiction of
N-(3,4-dimethoxyphenyl)-2-methyl-3-oxo-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine-2-carboxamide
N-(3,4-dimethoxyphenyl)-2-methyl-3-oxo-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine-2-carboxamide
Compound characteristics
| Compound ID: | P621-0010 |
| Compound Name: | N-(3,4-dimethoxyphenyl)-2-methyl-3-oxo-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine-2-carboxamide |
| Molecular Weight: | 343.34 |
| Molecular Formula: | C17 H17 N3 O5 |
| Smiles: | CC1(C(Nc2ccc(c(c2)OC)OC)=O)C(Nc2c(cccn2)O1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.5864 |
| logD: | 1.5855 |
| logSw: | -1.964 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 80.072 |
| InChI Key: | XTDICKHNEWKUNF-KRWDZBQOSA-N |