N-(2-methoxyphenyl)-2-methyl-3-oxo-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine-2-carboxamide
Chemical Structure Depiction of
N-(2-methoxyphenyl)-2-methyl-3-oxo-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine-2-carboxamide
N-(2-methoxyphenyl)-2-methyl-3-oxo-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine-2-carboxamide
Compound characteristics
| Compound ID: | P621-0046 |
| Compound Name: | N-(2-methoxyphenyl)-2-methyl-3-oxo-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine-2-carboxamide |
| Molecular Weight: | 313.31 |
| Molecular Formula: | C16 H15 N3 O4 |
| Smiles: | CC1(C(Nc2ccccc2OC)=O)C(Nc2c(cccn2)O1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.0028 |
| logD: | 2.0019 |
| logSw: | -2.3827 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 71.743 |
| InChI Key: | LYSBJWQWOJIWOB-INIZCTEOSA-N |