N-butyl-3-{1-[6-(ethylamino)pyrimidin-4-yl]piperidin-3-yl}-N-methylpropanamide
Chemical Structure Depiction of
N-butyl-3-{1-[6-(ethylamino)pyrimidin-4-yl]piperidin-3-yl}-N-methylpropanamide
N-butyl-3-{1-[6-(ethylamino)pyrimidin-4-yl]piperidin-3-yl}-N-methylpropanamide
Compound characteristics
| Compound ID: | P634-0195 |
| Compound Name: | N-butyl-3-{1-[6-(ethylamino)pyrimidin-4-yl]piperidin-3-yl}-N-methylpropanamide |
| Molecular Weight: | 347.5 |
| Molecular Formula: | C19 H33 N5 O |
| Smiles: | CCCCN(C)C(CCC1CCCN(C1)c1cc(NCC)ncn1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.2416 |
| logD: | 3.2298 |
| logSw: | -3.3664 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 49.47 |
| InChI Key: | OGTXQVBKJJGJJP-MRXNPFEDSA-N |