2-(4-bromophenyl)-1-[5-(1,2-oxazol-5-yl)-2,3-dihydro-1H-indol-1-yl]ethan-1-one
Chemical Structure Depiction of
2-(4-bromophenyl)-1-[5-(1,2-oxazol-5-yl)-2,3-dihydro-1H-indol-1-yl]ethan-1-one
2-(4-bromophenyl)-1-[5-(1,2-oxazol-5-yl)-2,3-dihydro-1H-indol-1-yl]ethan-1-one
Compound characteristics
| Compound ID: | P667-0093 |
| Compound Name: | 2-(4-bromophenyl)-1-[5-(1,2-oxazol-5-yl)-2,3-dihydro-1H-indol-1-yl]ethan-1-one |
| Molecular Weight: | 383.24 |
| Molecular Formula: | C19 H15 Br N2 O2 |
| Smiles: | C1CN(C(Cc2ccc(cc2)[Br])=O)c2ccc(cc12)c1ccno1 |
| Stereo: | ACHIRAL |
| logP: | 4.1866 |
| logD: | 4.1866 |
| logSw: | -4.3617 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 37.259 |
| InChI Key: | HVGLYTLLVLVGJK-UHFFFAOYSA-N |