3-{[2-(4-ethoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methyl}-5-(3-methoxyphenyl)-1,2,4-oxadiazole
Chemical Structure Depiction of
3-{[2-(4-ethoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methyl}-5-(3-methoxyphenyl)-1,2,4-oxadiazole
3-{[2-(4-ethoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methyl}-5-(3-methoxyphenyl)-1,2,4-oxadiazole
Compound characteristics
| Compound ID: | P668-0291 |
| Compound Name: | 3-{[2-(4-ethoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methyl}-5-(3-methoxyphenyl)-1,2,4-oxadiazole |
| Molecular Weight: | 391.43 |
| Molecular Formula: | C22 H21 N3 O4 |
| Smiles: | CCOc1ccc(cc1)c1nc(Cc2nc(c3cccc(c3)OC)on2)c(C)o1 |
| Stereo: | ACHIRAL |
| logP: | 4.7262 |
| logD: | 4.7262 |
| logSw: | -4.5866 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 65.424 |
| InChI Key: | OLTXOBNUYWORCJ-UHFFFAOYSA-N |