5-methoxy-1-methyl-1'-[(2-methylphenyl)acetyl]spiro[indole-3,3'-pyrrolidin]-2(1H)-one
Chemical Structure Depiction of
5-methoxy-1-methyl-1'-[(2-methylphenyl)acetyl]spiro[indole-3,3'-pyrrolidin]-2(1H)-one
5-methoxy-1-methyl-1'-[(2-methylphenyl)acetyl]spiro[indole-3,3'-pyrrolidin]-2(1H)-one
Compound characteristics
| Compound ID: | P681-0410 |
| Compound Name: | 5-methoxy-1-methyl-1'-[(2-methylphenyl)acetyl]spiro[indole-3,3'-pyrrolidin]-2(1H)-one |
| Molecular Weight: | 364.44 |
| Molecular Formula: | C22 H24 N2 O3 |
| Smiles: | Cc1ccccc1CC(N1CCC2(C1)C(N(C)c1ccc(cc12)OC)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.3166 |
| logD: | 3.3166 |
| logSw: | -3.6719 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 39.437 |
| InChI Key: | CCAHOKJJFWIGOY-QFIPXVFZSA-N |