1-(3-fluorophenyl)-N-[1-(4-fluorophenyl)ethyl]-4-hydroxy-2-oxo-1,2-dihydro-1,8-naphthyridine-3-carboxamide
Chemical Structure Depiction of
1-(3-fluorophenyl)-N-[1-(4-fluorophenyl)ethyl]-4-hydroxy-2-oxo-1,2-dihydro-1,8-naphthyridine-3-carboxamide
1-(3-fluorophenyl)-N-[1-(4-fluorophenyl)ethyl]-4-hydroxy-2-oxo-1,2-dihydro-1,8-naphthyridine-3-carboxamide
Compound characteristics
| Compound ID: | P682-1246 |
| Compound Name: | 1-(3-fluorophenyl)-N-[1-(4-fluorophenyl)ethyl]-4-hydroxy-2-oxo-1,2-dihydro-1,8-naphthyridine-3-carboxamide |
| Molecular Weight: | 421.4 |
| Molecular Formula: | C23 H17 F2 N3 O3 |
| Smiles: | CC(c1ccc(cc1)F)NC(C1=C(c2cccnc2N(C1=O)c1cccc(c1)F)O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.7039 |
| logD: | -0.2437 |
| logSw: | -3.2275 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 63.708 |
| InChI Key: | MKPRISKMKZXOAH-ZDUSSCGKSA-N |