1-benzyl-N-[1-(4-fluorophenyl)ethyl]-4-hydroxy-6-oxo-6,7-dihydro-1H-pyrazolo[3,4-b]pyridine-5-carboxamide
Chemical Structure Depiction of
1-benzyl-N-[1-(4-fluorophenyl)ethyl]-4-hydroxy-6-oxo-6,7-dihydro-1H-pyrazolo[3,4-b]pyridine-5-carboxamide
1-benzyl-N-[1-(4-fluorophenyl)ethyl]-4-hydroxy-6-oxo-6,7-dihydro-1H-pyrazolo[3,4-b]pyridine-5-carboxamide
Compound characteristics
| Compound ID: | P684-2253 |
| Compound Name: | 1-benzyl-N-[1-(4-fluorophenyl)ethyl]-4-hydroxy-6-oxo-6,7-dihydro-1H-pyrazolo[3,4-b]pyridine-5-carboxamide |
| Molecular Weight: | 406.42 |
| Molecular Formula: | C22 H19 F N4 O3 |
| Smiles: | [H]N1C(C(=C(c2cnn(Cc3ccccc3)c12)O)C(NC(C)c1ccc(cc1)F)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.1919 |
| logD: | -0.7904 |
| logSw: | -2.9771 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 77.578 |
| InChI Key: | RRLONWIMHBRIGJ-ZDUSSCGKSA-N |