(4-methoxy-2-methylphenyl)[5-(2-methyl-1,3-thiazol-4-yl)-2,3-dihydro-1H-indol-1-yl]methanone
Chemical Structure Depiction of
(4-methoxy-2-methylphenyl)[5-(2-methyl-1,3-thiazol-4-yl)-2,3-dihydro-1H-indol-1-yl]methanone
(4-methoxy-2-methylphenyl)[5-(2-methyl-1,3-thiazol-4-yl)-2,3-dihydro-1H-indol-1-yl]methanone
Compound characteristics
| Compound ID: | P725-0073 |
| Compound Name: | (4-methoxy-2-methylphenyl)[5-(2-methyl-1,3-thiazol-4-yl)-2,3-dihydro-1H-indol-1-yl]methanone |
| Molecular Weight: | 364.46 |
| Molecular Formula: | C21 H20 N2 O2 S |
| Smiles: | Cc1cc(ccc1C(N1CCc2cc(ccc12)c1csc(C)n1)=O)OC |
| Stereo: | ACHIRAL |
| logP: | 4.9171 |
| logD: | 4.9171 |
| logSw: | -4.5832 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 33.001 |
| InChI Key: | NSVSQUJUXMHTRQ-UHFFFAOYSA-N |