1-ethyl-1'-(4-fluoro-3-methylbenzene-1-sulfonyl)spiro[indole-3,4'-piperidin]-2(1H)-one
Chemical Structure Depiction of
1-ethyl-1'-(4-fluoro-3-methylbenzene-1-sulfonyl)spiro[indole-3,4'-piperidin]-2(1H)-one
1-ethyl-1'-(4-fluoro-3-methylbenzene-1-sulfonyl)spiro[indole-3,4'-piperidin]-2(1H)-one
Compound characteristics
| Compound ID: | P742-1083 |
| Compound Name: | 1-ethyl-1'-(4-fluoro-3-methylbenzene-1-sulfonyl)spiro[indole-3,4'-piperidin]-2(1H)-one |
| Molecular Weight: | 402.49 |
| Molecular Formula: | C21 H23 F N2 O3 S |
| Smiles: | CCN1C(C2(CCN(CC2)S(c2ccc(c(C)c2)F)(=O)=O)c2ccccc12)=O |
| Stereo: | ACHIRAL |
| logP: | 3.6575 |
| logD: | 3.6575 |
| logSw: | -3.8898 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 47.143 |
| InChI Key: | VGOQPEILQSOCEE-UHFFFAOYSA-N |