N-(3,5-difluorophenyl)-1-[2-(morpholin-4-yl)ethyl]-1H-benzotriazole-5-carboxamide
Chemical Structure Depiction of
N-(3,5-difluorophenyl)-1-[2-(morpholin-4-yl)ethyl]-1H-benzotriazole-5-carboxamide
N-(3,5-difluorophenyl)-1-[2-(morpholin-4-yl)ethyl]-1H-benzotriazole-5-carboxamide
Compound characteristics
| Compound ID: | P769-0530 |
| Compound Name: | N-(3,5-difluorophenyl)-1-[2-(morpholin-4-yl)ethyl]-1H-benzotriazole-5-carboxamide |
| Molecular Weight: | 387.39 |
| Molecular Formula: | C19 H19 F2 N5 O2 |
| Smiles: | C(Cn1c2ccc(cc2nn1)C(Nc1cc(cc(c1)F)F)=O)N1CCOCC1 |
| Stereo: | ACHIRAL |
| logP: | 2.129 |
| logD: | 1.8131 |
| logSw: | -2.9576 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 60.625 |
| InChI Key: | TUQKQEYCQVHRON-UHFFFAOYSA-N |