2-[4-(3-chlorophenyl)piperazin-1-yl]-1-(2,5-dimethoxyphenyl)ethan-1-ol
Chemical Structure Depiction of
2-[4-(3-chlorophenyl)piperazin-1-yl]-1-(2,5-dimethoxyphenyl)ethan-1-ol
2-[4-(3-chlorophenyl)piperazin-1-yl]-1-(2,5-dimethoxyphenyl)ethan-1-ol
Compound characteristics
| Compound ID: | P789-0158 |
| Compound Name: | 2-[4-(3-chlorophenyl)piperazin-1-yl]-1-(2,5-dimethoxyphenyl)ethan-1-ol |
| Molecular Weight: | 376.88 |
| Molecular Formula: | C20 H25 Cl N2 O3 |
| Smiles: | COc1ccc(c(c1)C(CN1CCN(CC1)c1cccc(c1)[Cl])O)OC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.4527 |
| logD: | 3.3728 |
| logSw: | -3.3324 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 38.558 |
| InChI Key: | ZXQUSNXXCQJOGQ-IBGZPJMESA-N |