1-(3,4-dimethoxyphenyl)-2-[4-(2,5-dimethylphenyl)piperazin-1-yl]ethan-1-ol
Chemical Structure Depiction of
1-(3,4-dimethoxyphenyl)-2-[4-(2,5-dimethylphenyl)piperazin-1-yl]ethan-1-ol
1-(3,4-dimethoxyphenyl)-2-[4-(2,5-dimethylphenyl)piperazin-1-yl]ethan-1-ol
Compound characteristics
| Compound ID: | P789-0391 |
| Compound Name: | 1-(3,4-dimethoxyphenyl)-2-[4-(2,5-dimethylphenyl)piperazin-1-yl]ethan-1-ol |
| Molecular Weight: | 370.49 |
| Molecular Formula: | C22 H30 N2 O3 |
| Smiles: | Cc1ccc(C)c(c1)N1CCN(CC1)CC(c1ccc(c(c1)OC)OC)O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.2738 |
| logD: | 3.2003 |
| logSw: | -3.1453 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 38.343 |
| InChI Key: | YALFQBDCKBSUMM-FQEVSTJZSA-N |