(3,4-dimethylphenyl)[4-(3-phenyl-1H-pyrazol-5-yl)piperazin-1-yl]methanone
Chemical Structure Depiction of
(3,4-dimethylphenyl)[4-(3-phenyl-1H-pyrazol-5-yl)piperazin-1-yl]methanone
(3,4-dimethylphenyl)[4-(3-phenyl-1H-pyrazol-5-yl)piperazin-1-yl]methanone
Compound characteristics
| Compound ID: | P804-0666 |
| Compound Name: | (3,4-dimethylphenyl)[4-(3-phenyl-1H-pyrazol-5-yl)piperazin-1-yl]methanone |
| Molecular Weight: | 360.46 |
| Molecular Formula: | C22 H24 N4 O |
| Smiles: | Cc1ccc(cc1C)C(N1CCN(CC1)c1cc(c2ccccc2)n[nH]1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.172 |
| logD: | 4.172 |
| logSw: | -4.1402 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 42.1 |
| InChI Key: | IIXMBLNTUOZKOH-UHFFFAOYSA-N |