(2,4-dimethoxyphenyl){4-[3-(thiophen-2-yl)-1H-pyrazol-5-yl]piperazin-1-yl}methanone
Chemical Structure Depiction of
(2,4-dimethoxyphenyl){4-[3-(thiophen-2-yl)-1H-pyrazol-5-yl]piperazin-1-yl}methanone
(2,4-dimethoxyphenyl){4-[3-(thiophen-2-yl)-1H-pyrazol-5-yl]piperazin-1-yl}methanone
Compound characteristics
| Compound ID: | P804-1114 |
| Compound Name: | (2,4-dimethoxyphenyl){4-[3-(thiophen-2-yl)-1H-pyrazol-5-yl]piperazin-1-yl}methanone |
| Molecular Weight: | 398.48 |
| Molecular Formula: | C20 H22 N4 O3 S |
| Smiles: | COc1ccc(C(N2CCN(CC2)c2cc(c3cccs3)n[nH]2)=O)c(c1)OC |
| Stereo: | ACHIRAL |
| logP: | 3.1215 |
| logD: | 3.1215 |
| logSw: | -3.4097 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 58.293 |
| InChI Key: | RWZPKZVLSOQVKO-UHFFFAOYSA-N |