(quinolin-6-yl){4-[3-(thiophen-2-yl)-1H-pyrazol-5-yl]piperazin-1-yl}methanone
Chemical Structure Depiction of
(quinolin-6-yl){4-[3-(thiophen-2-yl)-1H-pyrazol-5-yl]piperazin-1-yl}methanone
(quinolin-6-yl){4-[3-(thiophen-2-yl)-1H-pyrazol-5-yl]piperazin-1-yl}methanone
Compound characteristics
| Compound ID: | P804-1206 |
| Compound Name: | (quinolin-6-yl){4-[3-(thiophen-2-yl)-1H-pyrazol-5-yl]piperazin-1-yl}methanone |
| Molecular Weight: | 389.48 |
| Molecular Formula: | C21 H19 N5 O S |
| Smiles: | C1CN(CCN1C(c1ccc2c(cccn2)c1)=O)c1cc(c2cccs2)n[nH]1 |
| Stereo: | ACHIRAL |
| logP: | 3.0096 |
| logD: | 3.0096 |
| logSw: | -3.2786 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 51.882 |
| InChI Key: | UADUNVYVGDEGDV-UHFFFAOYSA-N |