(4-chlorophenyl){4-[3-(4-methoxyphenyl)-1H-pyrazol-5-yl]piperazin-1-yl}methanone
Chemical Structure Depiction of
(4-chlorophenyl){4-[3-(4-methoxyphenyl)-1H-pyrazol-5-yl]piperazin-1-yl}methanone
(4-chlorophenyl){4-[3-(4-methoxyphenyl)-1H-pyrazol-5-yl]piperazin-1-yl}methanone
Compound characteristics
| Compound ID: | P804-1238 |
| Compound Name: | (4-chlorophenyl){4-[3-(4-methoxyphenyl)-1H-pyrazol-5-yl]piperazin-1-yl}methanone |
| Molecular Weight: | 396.88 |
| Molecular Formula: | C21 H21 Cl N4 O2 |
| Smiles: | COc1ccc(cc1)c1cc([nH]n1)N1CCN(CC1)C(c1ccc(cc1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 3.9523 |
| logD: | 3.9523 |
| logSw: | -4.4523 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 49.644 |
| InChI Key: | UJCABTXZNURSJM-UHFFFAOYSA-N |