{4-[3-(4-methoxyphenyl)-1H-pyrazol-5-yl]piperazin-1-yl}(2-methylphenyl)methanone
Chemical Structure Depiction of
{4-[3-(4-methoxyphenyl)-1H-pyrazol-5-yl]piperazin-1-yl}(2-methylphenyl)methanone
{4-[3-(4-methoxyphenyl)-1H-pyrazol-5-yl]piperazin-1-yl}(2-methylphenyl)methanone
Compound characteristics
| Compound ID: | P804-1239 |
| Compound Name: | {4-[3-(4-methoxyphenyl)-1H-pyrazol-5-yl]piperazin-1-yl}(2-methylphenyl)methanone |
| Molecular Weight: | 376.46 |
| Molecular Formula: | C22 H24 N4 O2 |
| Smiles: | Cc1ccccc1C(N1CCN(CC1)c1cc(c2ccc(cc2)OC)n[nH]1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.7481 |
| logD: | 3.7481 |
| logSw: | -3.9135 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 49.644 |
| InChI Key: | ULPCBJLEWBYYPT-UHFFFAOYSA-N |