N-[1-(3-phenyl-1H-pyrazol-5-yl)piperidin-4-yl]furan-3-carboxamide
Chemical Structure Depiction of
N-[1-(3-phenyl-1H-pyrazol-5-yl)piperidin-4-yl]furan-3-carboxamide
N-[1-(3-phenyl-1H-pyrazol-5-yl)piperidin-4-yl]furan-3-carboxamide
Compound characteristics
| Compound ID: | P805-0678 |
| Compound Name: | N-[1-(3-phenyl-1H-pyrazol-5-yl)piperidin-4-yl]furan-3-carboxamide |
| Molecular Weight: | 336.39 |
| Molecular Formula: | C19 H20 N4 O2 |
| Smiles: | C1CN(CCC1NC(c1ccoc1)=O)c1cc(c2ccccc2)n[nH]1 |
| Stereo: | ACHIRAL |
| logP: | 2.9904 |
| logD: | 2.9904 |
| logSw: | -3.4002 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 57.394 |
| InChI Key: | QIQSBAFAHYCMSP-UHFFFAOYSA-N |