2-(4-fluorophenyl)-N-[1-(3-phenyl-1H-pyrazol-5-yl)piperidin-4-yl]acetamide
Chemical Structure Depiction of
2-(4-fluorophenyl)-N-[1-(3-phenyl-1H-pyrazol-5-yl)piperidin-4-yl]acetamide
2-(4-fluorophenyl)-N-[1-(3-phenyl-1H-pyrazol-5-yl)piperidin-4-yl]acetamide
Compound characteristics
| Compound ID: | P805-0687 |
| Compound Name: | 2-(4-fluorophenyl)-N-[1-(3-phenyl-1H-pyrazol-5-yl)piperidin-4-yl]acetamide |
| Molecular Weight: | 378.45 |
| Molecular Formula: | C22 H23 F N4 O |
| Smiles: | C1CN(CCC1NC(Cc1ccc(cc1)F)=O)c1cc(c2ccccc2)n[nH]1 |
| Stereo: | ACHIRAL |
| logP: | 3.5765 |
| logD: | 3.5765 |
| logSw: | -3.7181 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 49.377 |
| InChI Key: | BSBNYNXYIXXUMU-UHFFFAOYSA-N |