N-[1-(3-phenyl-1H-pyrazol-5-yl)piperidin-3-yl]-1H-indole-5-carboxamide
Chemical Structure Depiction of
N-[1-(3-phenyl-1H-pyrazol-5-yl)piperidin-3-yl]-1H-indole-5-carboxamide
N-[1-(3-phenyl-1H-pyrazol-5-yl)piperidin-3-yl]-1H-indole-5-carboxamide
Compound characteristics
| Compound ID: | P806-0570 |
| Compound Name: | N-[1-(3-phenyl-1H-pyrazol-5-yl)piperidin-3-yl]-1H-indole-5-carboxamide |
| Molecular Weight: | 385.47 |
| Molecular Formula: | C23 H23 N5 O |
| Smiles: | C1CC(CN(C1)c1cc(c2ccccc2)n[nH]1)NC(c1ccc2c(cc[nH]2)c1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.6891 |
| logD: | 3.6891 |
| logSw: | -4.0674 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 59.305 |
| InChI Key: | SAHWDHWXDFTJEA-IBGZPJMESA-N |