N-[1-(3-phenyl-1H-pyrazol-5-yl)piperidin-3-yl]-2-(trifluoromethyl)benzamide
Chemical Structure Depiction of
N-[1-(3-phenyl-1H-pyrazol-5-yl)piperidin-3-yl]-2-(trifluoromethyl)benzamide
N-[1-(3-phenyl-1H-pyrazol-5-yl)piperidin-3-yl]-2-(trifluoromethyl)benzamide
Compound characteristics
| Compound ID: | P806-0576 |
| Compound Name: | N-[1-(3-phenyl-1H-pyrazol-5-yl)piperidin-3-yl]-2-(trifluoromethyl)benzamide |
| Molecular Weight: | 414.43 |
| Molecular Formula: | C22 H21 F3 N4 O |
| Smiles: | C1CC(CN(C1)c1cc(c2ccccc2)n[nH]1)NC(c1ccccc1C(F)(F)F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.3461 |
| logD: | 4.3457 |
| logSw: | -4.3112 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 49.524 |
| InChI Key: | BOJUXODLAVBORC-INIZCTEOSA-N |