3-chloro-N-{1-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]piperidin-3-yl}benzamide
Chemical Structure Depiction of
3-chloro-N-{1-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]piperidin-3-yl}benzamide
3-chloro-N-{1-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]piperidin-3-yl}benzamide
Compound characteristics
| Compound ID: | P806-0721 |
| Compound Name: | 3-chloro-N-{1-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]piperidin-3-yl}benzamide |
| Molecular Weight: | 398.87 |
| Molecular Formula: | C21 H20 Cl F N4 O |
| Smiles: | C1CC(CN(C1)c1cc(c2ccc(cc2)F)n[nH]1)NC(c1cccc(c1)[Cl])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.4619 |
| logD: | 4.4619 |
| logSw: | -4.6375 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 49.524 |
| InChI Key: | JUJVHQPNLZGXMY-SFHVURJKSA-N |