3,4-diethoxy-N-[1-(3-phenyl-1H-pyrazol-5-yl)pyrrolidin-3-yl]benzamide
Chemical Structure Depiction of
3,4-diethoxy-N-[1-(3-phenyl-1H-pyrazol-5-yl)pyrrolidin-3-yl]benzamide
3,4-diethoxy-N-[1-(3-phenyl-1H-pyrazol-5-yl)pyrrolidin-3-yl]benzamide
Compound characteristics
| Compound ID: | P809-0616 |
| Compound Name: | 3,4-diethoxy-N-[1-(3-phenyl-1H-pyrazol-5-yl)pyrrolidin-3-yl]benzamide |
| Molecular Weight: | 420.51 |
| Molecular Formula: | C24 H28 N4 O3 |
| Smiles: | CCOc1ccc(cc1OCC)C(NC1CCN(C1)c1cc(c2ccccc2)n[nH]1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.5923 |
| logD: | 3.5923 |
| logSw: | -3.7178 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 64.311 |
| InChI Key: | KFTLKIRWWWPVAZ-IBGZPJMESA-N |