9-[1-(2-ethoxybenzoyl)pyrrolidin-3-yl]-7,9-dihydro-8H-purin-8-one
Chemical Structure Depiction of
9-[1-(2-ethoxybenzoyl)pyrrolidin-3-yl]-7,9-dihydro-8H-purin-8-one
9-[1-(2-ethoxybenzoyl)pyrrolidin-3-yl]-7,9-dihydro-8H-purin-8-one
Compound characteristics
| Compound ID: | P814-4716 |
| Compound Name: | 9-[1-(2-ethoxybenzoyl)pyrrolidin-3-yl]-7,9-dihydro-8H-purin-8-one |
| Molecular Weight: | 353.38 |
| Molecular Formula: | C18 H19 N5 O3 |
| Smiles: | CCOc1ccccc1C(N1CCC(C1)N1C(Nc2cncnc12)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.4933 |
| logD: | 1.4933 |
| logSw: | -2.0286 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 71.812 |
| InChI Key: | FQKDRCOMNHMHNQ-LBPRGKRZSA-N |