9-[1-(1-ethyl-1H-pyrazole-3-carbonyl)piperidin-3-yl]-7-methyl-7,9-dihydro-8H-purin-8-one
Chemical Structure Depiction of
9-[1-(1-ethyl-1H-pyrazole-3-carbonyl)piperidin-3-yl]-7-methyl-7,9-dihydro-8H-purin-8-one
9-[1-(1-ethyl-1H-pyrazole-3-carbonyl)piperidin-3-yl]-7-methyl-7,9-dihydro-8H-purin-8-one
Compound characteristics
| Compound ID: | P814-5478 |
| Compound Name: | 9-[1-(1-ethyl-1H-pyrazole-3-carbonyl)piperidin-3-yl]-7-methyl-7,9-dihydro-8H-purin-8-one |
| Molecular Weight: | 355.4 |
| Molecular Formula: | C17 H21 N7 O2 |
| Smiles: | CCn1ccc(C(N2CCCC(C2)N2C(N(C)c3cncnc23)=O)=O)n1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 0.1692 |
| logD: | 0.1692 |
| logSw: | -0.7554 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 69.445 |
| InChI Key: | LLOCUKVPEBQMCT-LBPRGKRZSA-N |