N-[2-(8-oxo-7,8-dihydro-9H-purin-9-yl)ethyl]-2-phenoxypropanamide
Chemical Structure Depiction of
N-[2-(8-oxo-7,8-dihydro-9H-purin-9-yl)ethyl]-2-phenoxypropanamide
N-[2-(8-oxo-7,8-dihydro-9H-purin-9-yl)ethyl]-2-phenoxypropanamide
Compound characteristics
| Compound ID: | P814-6591 |
| Compound Name: | N-[2-(8-oxo-7,8-dihydro-9H-purin-9-yl)ethyl]-2-phenoxypropanamide |
| Molecular Weight: | 327.34 |
| Molecular Formula: | C16 H17 N5 O3 |
| Smiles: | CC(C(NCCN1C(Nc2cncnc12)=O)=O)Oc1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.2183 |
| logD: | 1.2182 |
| logSw: | -1.5994 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 79.919 |
| InChI Key: | RFFQQHMNUXBDBF-UHFFFAOYSA-N |