N-[2-(diethylamino)ethyl]-5-oxo-1-(2-phenylethyl)pyrrolidine-3-carboxamide
Chemical Structure Depiction of
N-[2-(diethylamino)ethyl]-5-oxo-1-(2-phenylethyl)pyrrolidine-3-carboxamide
N-[2-(diethylamino)ethyl]-5-oxo-1-(2-phenylethyl)pyrrolidine-3-carboxamide
Compound characteristics
| Compound ID: | P888-0116 |
| Compound Name: | N-[2-(diethylamino)ethyl]-5-oxo-1-(2-phenylethyl)pyrrolidine-3-carboxamide |
| Molecular Weight: | 331.46 |
| Molecular Formula: | C19 H29 N3 O2 |
| Smiles: | CCN(CC)CCNC(C1CC(N(CCc2ccccc2)C1)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.2459 |
| logD: | -0.6854 |
| logSw: | -1.7519 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.35 |
| InChI Key: | DVFHZMPOSHIIQL-QGZVFWFLSA-N |